C30H26F2N2O3 — CID 142841286
N-[1-amino-3-[4-(1,1-difluoroprop-2-enyl)phenyl]-1-oxopropan-2-yl]-6-phenylmethoxynaphthalene-2-carboxamide (PubChem CID 142841286) has the molecular formula C30H26F2N2O3 and a molecular weight of 500.55 g/mol. Its IUPAC name is N-[1-amino-3-[4-(1,1-difluoroprop-2-enyl)phenyl]-1-oxopropan-2-yl]-6-phenylmethoxynaphthalene-2-carboxamide.
| Compound Name | N-[1-amino-3-[4-(1,1-difluoroprop-2-enyl)phenyl]-1-oxopropan-2-yl]-6-phenylmethoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 142841286 |
| Molecular Formula | C30H26F2N2O3 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[1-amino-3-[4-(1,1-difluoroprop-2-enyl)phenyl]-1-oxopropan-2-yl]-6-phenylmethoxynaphthalene-2-carboxamide |
| SMILES | C=CC(F)(F)c1ccc(CC(NC(=O)c2ccc3cc(OCc4ccccc4)ccc3c2)C(N)=O)cc1 |
| InChI | InChI=1S/C30H26F2N2O3/c1-2-30(31,32)25-13-8-20(9-14-25)16-27(28(33)35)34-29(36)24-11-10-23-18-26(15-12-22(23)17-24)37-19-21-6-4-3-5-7-21/h2-15,17-18,27H,1,16,19H2,(H2,33,35)(H,34,36) |
| InChIKey | NTEPRHTVQQQNSZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|