C27H22ClNO4 — CID 58677412
2-[[6-[(4-chlorophenyl)methoxy]naphthalene-2-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 58677412) has the molecular formula C27H22ClNO4 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-[[6-[(4-chlorophenyl)methoxy]naphthalene-2-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-[(4-chlorophenyl)methoxy]naphthalene-2-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 58677412 |
| Molecular Formula | C27H22ClNO4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[[6-[(4-chlorophenyl)methoxy]naphthalene-2-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccc2cc(OCc3ccc(Cl)cc3)ccc2c1 |
| InChI | InChI=1S/C27H22ClNO4/c28-23-11-6-19(7-12-23)17-33-24-13-10-20-15-22(9-8-21(20)16-24)26(30)29-25(27(31)32)14-18-4-2-1-3-5-18/h1-13,15-16,25H,14,17H2,(H,29,30)(H,31,32) |
| InChIKey | DIJGDSZJOZUURM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |