C39H38N2O5 — CID 66912654
(2S)-2-[[4-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 66912654) has the molecular formula C39H38N2O5 and a molecular weight of 614.74 g/mol. Its IUPAC name is (2S)-2-[[4-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[4-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 66912654 |
| Molecular Formula | C39H38N2O5 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | (2S)-2-[[4-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1ccc(OCCN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C39H38N2O5/c42-38(40-37(39(43)44)26-30-16-20-36(21-17-30)46-29-33-14-8-3-9-15-33)34-18-22-35(23-19-34)45-25-24-41(27-31-10-4-1-5-11-31)28-32-12-6-2-7-13-32/h1-23,37H,24-29H2,(H,40,42)(H,43,44)/t37-/m0/s1 |
| InChIKey | JYPJZXYLJWQXBT-QNGWXLTQSA-N |
| XLogP | 6.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |