C38H36N2O5 — CID 66912967
2-[[3-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(3-phenoxyphenyl)propanoic acid (PubChem CID 66912967) has the molecular formula C38H36N2O5 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-[[3-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(3-phenoxyphenyl)propanoic acid.
| Compound Name | 2-[[3-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(3-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 66912967 |
| Molecular Formula | C38H36N2O5 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 2-[[3-[2-(dibenzylamino)ethoxy]benzoyl]amino]-3-(3-phenoxyphenyl)propanoic acid |
| SMILES | O=C(NC(Cc1cccc(Oc2ccccc2)c1)C(=O)O)c1cccc(OCCN(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C38H36N2O5/c41-37(39-36(38(42)43)25-31-16-10-21-35(24-31)45-33-18-8-3-9-19-33)32-17-11-20-34(26-32)44-23-22-40(27-29-12-4-1-5-13-29)28-30-14-6-2-7-15-30/h1-21,24,26,36H,22-23,25,27-28H2,(H,39,41)(H,42,43) |
| InChIKey | QARADGJIKSEPIV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |