C40H40N2O5 — CID 66912637
methyl 3-[[4-[2-(dibenzylamino)ethoxy]benzoyl]-[(3-phenoxyphenyl)methyl]amino]propanoate (PubChem CID 66912637) has the molecular formula C40H40N2O5 and a molecular weight of 628.77 g/mol. Its IUPAC name is methyl 3-[[4-[2-(dibenzylamino)ethoxy]benzoyl]-[(3-phenoxyphenyl)methyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[2-(dibenzylamino)ethoxy]benzoyl]-[(3-phenoxyphenyl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 66912637 |
| Molecular Formula | C40H40N2O5 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | methyl 3-[[4-[2-(dibenzylamino)ethoxy]benzoyl]-[(3-phenoxyphenyl)methyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1cccc(Oc2ccccc2)c1)C(=O)c1ccc(OCCN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40N2O5/c1-45-39(43)24-25-42(31-34-16-11-19-38(28-34)47-37-17-9-4-10-18-37)40(44)35-20-22-36(23-21-35)46-27-26-41(29-32-12-5-2-6-13-32)30-33-14-7-3-8-15-33/h2-23,28H,24-27,29-31H2,1H3 |
| InChIKey | UHFWPEQXZWFBKR-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |