C29H27NO3 — CID 54481452
N-[[3-(4-methylphenoxy)phenyl]methyl]-N-(2-phenoxyethyl)benzamide (PubChem CID 54481452) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[[3-(4-methylphenoxy)phenyl]methyl]-N-(2-phenoxyethyl)benzamide.
| Compound Name | N-[[3-(4-methylphenoxy)phenyl]methyl]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 54481452 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[[3-(4-methylphenoxy)phenyl]methyl]-N-(2-phenoxyethyl)benzamide |
| SMILES | Cc1ccc(Oc2cccc(CN(CCOc3ccccc3)C(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H27NO3/c1-23-15-17-27(18-16-23)33-28-14-8-9-24(21-28)22-30(29(31)25-10-4-2-5-11-25)19-20-32-26-12-6-3-7-13-26/h2-18,21H,19-20,22H2,1H3 |
| InChIKey | XPGOZHWYTQQRPI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |