C23H22FNO3 — CID 23856943
3-[(4-fluorophenyl)methyl-[(3-phenoxyphenyl)methyl]amino]propanoic acid (PubChem CID 23856943) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl-[(3-phenoxyphenyl)methyl]amino]propanoic acid.
| Compound Name | 3-[(4-fluorophenyl)methyl-[(3-phenoxyphenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23856943 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl-[(3-phenoxyphenyl)methyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccc(F)cc1)Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H22FNO3/c24-20-11-9-18(10-12-20)16-25(14-13-23(26)27)17-19-5-4-8-22(15-19)28-21-6-2-1-3-7-21/h1-12,15H,13-14,16-17H2,(H,26,27) |
| InChIKey | ATIMBOOWWVKASX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |