About azane;3-(dibenzylamino)propanoic acid
azane;3-(dibenzylamino)propanoic acid (PubChem CID 162310692) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is azane;3-(dibenzylamino)propanoic acid.
Molecular Properties
| Compound Name | azane;3-(dibenzylamino)propanoic acid |
| PubChem CID | 162310692 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | azane;3-(dibenzylamino)propanoic acid |
| SMILES | N.O=C(O)CCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO2.H3N/c19-17(20)11-12-18(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16;/h1-10H,11-14H2,(H,19,20);1H3 |
| InChIKey | YRFVKQLVDYIDGJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;3-(dibenzylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-(dibenzylamino)propanoic acid?
The IUPAC name of azane;3-(dibenzylamino)propanoic acid (CID 162310692) is azane;3-(dibenzylamino)propanoic acid.
What is the SMILES notation for azane;3-(dibenzylamino)propanoic acid?
The canonical SMILES for azane;3-(dibenzylamino)propanoic acid is N.O=C(O)CCN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of azane;3-(dibenzylamino)propanoic acid?
The InChIKey is YRFVKQLVDYIDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2.H3N/c19-17(20)11-12-18(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16;/h1-10H,11-14H2,(H,19,20);1H3.
What are the key properties of azane;3-(dibenzylamino)propanoic acid?
azane;3-(dibenzylamino)propanoic acid has a molecular weight of 286.38 g/mol, XLogP of 3.33, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-(dibenzylamino)propanoic acid is sourced from PubChem (CID 162310692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).