C33H35BrN2O3 — CID 66912882
3-[(4-bromophenyl)methyl-[[3-[2-(dibenzylamino)ethoxy]phenyl]methyl]amino]propanoic acid (PubChem CID 66912882) has the molecular formula C33H35BrN2O3 and a molecular weight of 587.56 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl-[[3-[2-(dibenzylamino)ethoxy]phenyl]methyl]amino]propanoic acid.
| Compound Name | 3-[(4-bromophenyl)methyl-[[3-[2-(dibenzylamino)ethoxy]phenyl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66912882 |
| Molecular Formula | C33H35BrN2O3 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 3-[(4-bromophenyl)methyl-[[3-[2-(dibenzylamino)ethoxy]phenyl]methyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccc(Br)cc1)Cc1cccc(OCCN(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C33H35BrN2O3/c34-31-16-14-29(15-17-31)25-35(19-18-33(37)38)26-30-12-7-13-32(22-30)39-21-20-36(23-27-8-3-1-4-9-27)24-28-10-5-2-6-11-28/h1-17,22H,18-21,23-26H2,(H,37,38) |
| InChIKey | CVMYRJTVHZLOHH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |