C25H28N2O3 — CID 70128798
3-[3-(4-benzylphenoxy)propyl-(pyridin-3-ylmethyl)amino]propanoic acid (PubChem CID 70128798) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[3-(4-benzylphenoxy)propyl-(pyridin-3-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[3-(4-benzylphenoxy)propyl-(pyridin-3-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70128798 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-[3-(4-benzylphenoxy)propyl-(pyridin-3-ylmethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCCOc1ccc(Cc2ccccc2)cc1)Cc1cccnc1 |
| InChI | InChI=1S/C25H28N2O3/c28-25(29)13-16-27(20-23-8-4-14-26-19-23)15-5-17-30-24-11-9-22(10-12-24)18-21-6-2-1-3-7-21/h1-4,6-12,14,19H,5,13,15-18,20H2,(H,28,29) |
| InChIKey | VSEHTCQNVKJQJN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|