C26H28N2O6S — CID 55513753
methyl 3-[benzyl-[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]propanoate (PubChem CID 55513753) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is methyl 3-[benzyl-[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 55513753 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | methyl 3-[benzyl-[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]propanoate |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(C(=O)N(CCC(=O)OC)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-3-34-23-13-11-22(12-14-23)27-35(31,32)24-15-9-21(10-16-24)26(30)28(18-17-25(29)33-2)19-20-7-5-4-6-8-20/h4-16,27H,3,17-19H2,1-2H3 |
| InChIKey | ZCMWJDXWXCAMRJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |