C28H26N2O3S — CID 1252923
N,N-dibenzyl-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 1252923) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is N,N-dibenzyl-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N,N-dibenzyl-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 1252923 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N,N-dibenzyl-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(Cc3ccccc3)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O3S/c1-22-12-18-27(19-13-22)34(32,33)29-26-16-14-25(15-17-26)28(31)30(20-23-8-4-2-5-9-23)21-24-10-6-3-7-11-24/h2-19,29H,20-21H2,1H3 |
| InChIKey | JCCYXCLXDOSUOF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |