C22H21NO4S — CID 68689392
4-[2-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68689392) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-[2-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68689392 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-[2-[4-[(4-methylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(CCc3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H21NO4S/c1-16-2-14-21(15-3-16)28(26,27)23-20-12-8-18(9-13-20)5-4-17-6-10-19(11-7-17)22(24)25/h2-3,6-15,23H,4-5H2,1H3,(H,24,25) |
| InChIKey | GCOHPWWVHXKBKQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |