C18H15NO5S — CID 91679907
5-[4-[(4-methylphenyl)sulfamoyl]phenyl]furan-2-carboxylic acid (PubChem CID 91679907) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is 5-[4-[(4-methylphenyl)sulfamoyl]phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-[(4-methylphenyl)sulfamoyl]phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 91679907 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 5-[4-[(4-methylphenyl)sulfamoyl]phenyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(-c3ccc(C(=O)O)o3)cc2)cc1 |
| InChI | InChI=1S/C18H15NO5S/c1-12-2-6-14(7-3-12)19-25(22,23)15-8-4-13(5-9-15)16-10-11-17(24-16)18(20)21/h2-11,19H,1H3,(H,20,21) |
| InChIKey | FZVDXOQPCPUUDW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |