C18H14ClNO5S — CID 91688170
5-[2-[(4-chlorophenyl)sulfonylamino]-4-methylphenyl]furan-2-carboxylic acid (PubChem CID 91688170) has the molecular formula C18H14ClNO5S and a molecular weight of 391.83 g/mol. Its IUPAC name is 5-[2-[(4-chlorophenyl)sulfonylamino]-4-methylphenyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-[(4-chlorophenyl)sulfonylamino]-4-methylphenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 91688170 |
| Molecular Formula | C18H14ClNO5S |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 5-[2-[(4-chlorophenyl)sulfonylamino]-4-methylphenyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)o2)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H14ClNO5S/c1-11-2-7-14(16-8-9-17(25-16)18(21)22)15(10-11)20-26(23,24)13-5-3-12(19)4-6-13/h2-10,20H,1H3,(H,21,22) |
| InChIKey | PIEAGYXXLJQPJJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |