C18H20N2O4S — CID 91687763
5-[2-(2,2-dimethylpropanoylcarbamothioylamino)-4-methylphenyl]furan-2-carboxylic acid (PubChem CID 91687763) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 5-[2-(2,2-dimethylpropanoylcarbamothioylamino)-4-methylphenyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-(2,2-dimethylpropanoylcarbamothioylamino)-4-methylphenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 91687763 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-[2-(2,2-dimethylpropanoylcarbamothioylamino)-4-methylphenyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)o2)c(NC(=S)NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-10-5-6-11(13-7-8-14(24-13)15(21)22)12(9-10)19-17(25)20-16(23)18(2,3)4/h5-9H,1-4H3,(H,21,22)(H2,19,20,23,25) |
| InChIKey | NBSOTEKLKSXYQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|