C16H16ClNO4S — CID 7516441
3-[4-[(2-chloro-4-methylphenyl)sulfamoyl]phenyl]propanoic acid (PubChem CID 7516441) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is 3-[4-[(2-chloro-4-methylphenyl)sulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(2-chloro-4-methylphenyl)sulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 7516441 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 3-[4-[(2-chloro-4-methylphenyl)sulfamoyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(CCC(=O)O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-11-2-8-15(14(17)10-11)18-23(21,22)13-6-3-12(4-7-13)5-9-16(19)20/h2-4,6-8,10,18H,5,9H2,1H3,(H,19,20) |
| InChIKey | FQINAZWEPCADMB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |