C18H22N2O3S — CID 94618182
N-[2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]ethyl]acetamide (PubChem CID 94618182) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 94618182 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[2-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(S(=O)(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13-4-9-18(14(2)12-13)20-24(22,23)17-7-5-16(6-8-17)10-11-19-15(3)21/h4-9,12,20H,10-11H2,1-3H3,(H,19,21) |
| InChIKey | XHVSZORSOBULSZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |