C21H27N3O6S — CID 2974906
N-[2-[[4-(2-acetamidoethyl)phenyl]sulfonylamino]-4-ethoxyphenyl]-2-hydroxypropanamide (PubChem CID 2974906) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[2-[[4-(2-acetamidoethyl)phenyl]sulfonylamino]-4-ethoxyphenyl]-2-hydroxypropanamide.
| Compound Name | N-[2-[[4-(2-acetamidoethyl)phenyl]sulfonylamino]-4-ethoxyphenyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 2974906 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[2-[[4-(2-acetamidoethyl)phenyl]sulfonylamino]-4-ethoxyphenyl]-2-hydroxypropanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)O)c(NS(=O)(=O)c2ccc(CCNC(C)=O)cc2)c1 |
| InChI | InChI=1S/C21H27N3O6S/c1-4-30-17-7-10-19(23-21(27)14(2)25)20(13-17)24-31(28,29)18-8-5-16(6-9-18)11-12-22-15(3)26/h5-10,13-14,24-25H,4,11-12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | SNDXLAPIQDEAGW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |