C24H26N4O4S2 — CID 4847637
1-[[3-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-(2-phenylethyl)thiourea (PubChem CID 4847637) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-[[3-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[[3-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 4847637 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-[[3-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-(2-phenylethyl)thiourea |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C(=O)NNC(=S)NCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O4S2/c1-2-32-21-11-13-22(14-12-21)34(30,31)28-20-10-6-9-19(17-20)23(29)26-27-24(33)25-16-15-18-7-4-3-5-8-18/h3-14,17,28H,2,15-16H2,1H3,(H,26,29)(H2,25,27,33) |
| InChIKey | FBXPIGAVSPCSCM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|