C18H22N4O4S2 — CID 2347505
1-[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-ethylthiourea (PubChem CID 2347505) has the molecular formula C18H22N4O4S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-ethylthiourea.
| Compound Name | 1-[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 2347505 |
| Molecular Formula | C18H22N4O4S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[[2-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)c1ccccc1NS(=O)(=O)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C18H22N4O4S2/c1-3-19-18(27)21-20-17(23)15-7-5-6-8-16(15)22-28(24,25)14-11-9-13(10-12-14)26-4-2/h5-12,22H,3-4H2,1-2H3,(H,20,23)(H2,19,21,27) |
| InChIKey | FZQALHRSACRDNU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|