C19H21NO6S — CID 30044248
[(2S)-3-oxobutan-2-yl] 2-[(4-ethoxyphenyl)sulfonylamino]benzoate (PubChem CID 30044248) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is [(2S)-3-oxobutan-2-yl] 2-[(4-ethoxyphenyl)sulfonylamino]benzoate.
| Compound Name | [(2S)-3-oxobutan-2-yl] 2-[(4-ethoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 30044248 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [(2S)-3-oxobutan-2-yl] 2-[(4-ethoxyphenyl)sulfonylamino]benzoate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O[C@@H](C)C(C)=O)cc1 |
| InChI | InChI=1S/C19H21NO6S/c1-4-25-15-9-11-16(12-10-15)27(23,24)20-18-8-6-5-7-17(18)19(22)26-14(3)13(2)21/h5-12,14,20H,4H2,1-3H3/t14-/m0/s1 |
| InChIKey | IAZDFRYBWCNFSP-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |