C16H15FN2O5S — CID 7744842
[(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]benzoate (PubChem CID 7744842) has the molecular formula C16H15FN2O5S and a molecular weight of 366.37 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]benzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 7744842 |
| Molecular Formula | C16H15FN2O5S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1NS(=O)(=O)c1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C16H15FN2O5S/c1-10(15(18)20)24-16(21)13-4-2-3-5-14(13)19-25(22,23)12-8-6-11(17)7-9-12/h2-10,19H,1H3,(H2,18,20)/t10-/m0/s1 |
| InChIKey | DJVILJZHDPZQQQ-JTQLQIEISA-N |
| XLogP | 1.66 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |