C16H15ClN2O5S — CID 42900642
(1-amino-1-oxopropan-2-yl) 2-[(4-chlorophenyl)sulfonylamino]benzoate (PubChem CID 42900642) has the molecular formula C16H15ClN2O5S and a molecular weight of 382.83 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 2-[(4-chlorophenyl)sulfonylamino]benzoate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 2-[(4-chlorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 42900642 |
| Molecular Formula | C16H15ClN2O5S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 2-[(4-chlorophenyl)sulfonylamino]benzoate |
| SMILES | CC(OC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C16H15ClN2O5S/c1-10(15(18)20)24-16(21)13-4-2-3-5-14(13)19-25(22,23)12-8-6-11(17)7-9-12/h2-10,19H,1H3,(H2,18,20) |
| InChIKey | XORFYXUDTSKGQR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |