C21H15Cl2NO5S — CID 16521702
[2-(4-chlorophenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate (PubChem CID 16521702) has the molecular formula C21H15Cl2NO5S and a molecular weight of 464.33 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16521702 |
| Molecular Formula | C21H15Cl2NO5S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15Cl2NO5S/c22-15-7-5-14(6-8-15)20(25)13-29-21(26)18-3-1-2-4-19(18)24-30(27,28)17-11-9-16(23)10-12-17/h1-12,24H,13H2 |
| InChIKey | GOSFTDPSOMMMLF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |