About [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate
[2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate (PubChem CID 587174) has the molecular formula C15H10Cl2O3
and a molecular weight of 309.15 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate |
| PubChem CID | 587174 |
| Molecular Formula | C15H10Cl2O3 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10Cl2O3/c16-11-7-5-10(6-8-11)14(18)9-20-15(19)12-3-1-2-4-13(12)17/h1-8H,9H2 |
| InChIKey | HGSLURSUZKFJKZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate?
The IUPAC name of [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate (CID 587174) is [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate.
What is the SMILES notation for [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate?
The canonical SMILES for [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate is O=C(COC(=O)c1ccccc1Cl)c1ccc(Cl)cc1.
What is the InChIKey of [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate?
The InChIKey is HGSLURSUZKFJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2O3/c16-11-7-5-10(6-8-11)14(18)9-20-15(19)12-3-1-2-4-13(12)17/h1-8H,9H2.
What are the key properties of [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate?
[2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate has a molecular weight of 309.15 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-chlorophenyl)-2-oxoethyl] 2-chlorobenzoate is sourced from PubChem (CID 587174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).