C22H13Cl3O4 — CID 23793601
[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 23793601) has the molecular formula C22H13Cl3O4 and a molecular weight of 447.70 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 23793601 |
| Molecular Formula | C22H13Cl3O4 |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H13Cl3O4/c23-14-7-5-13(6-8-14)21(27)16-3-1-2-4-17(16)22(28)29-12-20(26)18-11-15(24)9-10-19(18)25/h1-11H,12H2 |
| InChIKey | INLGWLFTDWRNPS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |