C22H12Cl3NO6 — CID 23882207
[2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate (PubChem CID 23882207) has the molecular formula C22H12Cl3NO6 and a molecular weight of 492.70 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate.
| Compound Name | [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 23882207 |
| Molecular Formula | C22H12Cl3NO6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | [2-(2,5-dichlorophenyl)-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H12Cl3NO6/c23-13-6-8-17(24)16(10-13)20(27)11-32-22(29)15-4-2-1-3-14(15)21(28)12-5-7-18(25)19(9-12)26(30)31/h1-10H,11H2 |
| InChIKey | QUSOCKGXEFGFQO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|