C15H8BrCl2NO5 — CID 1338643
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-bromo-3-nitrobenzoate (PubChem CID 1338643) has the molecular formula C15H8BrCl2NO5 and a molecular weight of 433.04 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-bromo-3-nitrobenzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 1338643 |
| Molecular Formula | C15H8BrCl2NO5 |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-bromo-3-nitrobenzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H8BrCl2NO5/c16-11-4-1-8(5-13(11)19(22)23)15(21)24-7-14(20)10-3-2-9(17)6-12(10)18/h1-6H,7H2 |
| InChIKey | GFUNLAPXLRUASA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|