C22H14Cl2N2O6 — CID 1106704
[2-(4-nitrophenyl)-2-oxoethyl] 3-[(2,4-dichlorobenzoyl)amino]benzoate (PubChem CID 1106704) has the molecular formula C22H14Cl2N2O6 and a molecular weight of 473.27 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 3-[(2,4-dichlorobenzoyl)amino]benzoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(2,4-dichlorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 1106704 |
| Molecular Formula | C22H14Cl2N2O6 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(2,4-dichlorobenzoyl)amino]benzoate |
| SMILES | O=C(COC(=O)c1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H14Cl2N2O6/c23-15-6-9-18(19(24)11-15)21(28)25-16-3-1-2-14(10-16)22(29)32-12-20(27)13-4-7-17(8-5-13)26(30)31/h1-11H,12H2,(H,25,28) |
| InChIKey | LJWOWKQMKCWVAP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|