C25H17N3O7 — CID 1128716
[2-(4-nitrophenyl)-2-oxoethyl] 3-[(2-oxo-1H-quinoline-4-carbonyl)amino]benzoate (PubChem CID 1128716) has the molecular formula C25H17N3O7 and a molecular weight of 471.43 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 3-[(2-oxo-1H-quinoline-4-carbonyl)amino]benzoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(2-oxo-1H-quinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 1128716 |
| Molecular Formula | C25H17N3O7 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(2-oxo-1H-quinoline-4-carbonyl)amino]benzoate |
| SMILES | O=C(COC(=O)c1cccc(NC(=O)c2cc(=O)[nH]c3ccccc23)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H17N3O7/c29-22(15-8-10-18(11-9-15)28(33)34)14-35-25(32)16-4-3-5-17(12-16)26-24(31)20-13-23(30)27-21-7-2-1-6-19(20)21/h1-13H,14H2,(H,26,31)(H,27,30) |
| InChIKey | WPOGRCXNJNMFCT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 148.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|