C18H11Br2N3O6 — CID 16796671
[2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 16796671) has the molecular formula C18H11Br2N3O6 and a molecular weight of 525.11 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16796671 |
| Molecular Formula | C18H11Br2N3O6 |
| Molecular Weight | 525.11 g/mol |
| Exact Mass | 522.90 |
| IUPAC Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H11Br2N3O6/c19-12-5-9(23(27)28)6-13(20)17(12)22-16(25)8-29-18(26)11-7-15(24)21-14-4-2-1-3-10(11)14/h1-7H,8H2,(H,21,24)(H,22,25) |
| InChIKey | UGLNAVOXYKPCLO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|