C22H23N3O6S — CID 2358570
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2358570) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2358570 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2cc(=O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-3-25(4-2)32(29,30)16-11-9-15(10-12-16)23-21(27)14-31-22(28)18-13-20(26)24-19-8-6-5-7-17(18)19/h5-13H,3-4,14H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | ISAICHGLFNMHKS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |