C21H22ClN3O5S — CID 55704140
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate (PubChem CID 55704140) has the molecular formula C21H22ClN3O5S and a molecular weight of 463.94 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 55704140 |
| Molecular Formula | C21H22ClN3O5S |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2[nH]c3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O5S/c1-3-25(4-2)31(28,29)15-11-9-14(10-12-15)23-18(26)13-30-21(27)20-19(22)16-7-5-6-8-17(16)24-20/h5-12,24H,3-4,13H2,1-2H3,(H,23,26) |
| InChIKey | SDLOJTPGRPHGIZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |