C22H21ClN2O4 — CID 46459618
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate (PubChem CID 46459618) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46459618 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)c2[nH]c3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-13(2)11-19(27)24-15-9-7-14(8-10-15)18(26)12-29-22(28)21-20(23)16-5-3-4-6-17(16)25-21/h3-10,13,25H,11-12H2,1-2H3,(H,24,27) |
| InChIKey | VCJFRNUFGXTTCY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |