C21H21ClN2O5 — CID 55704162
[2-(3,4-diethoxyanilino)-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate (PubChem CID 55704162) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 55704162 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2[nH]c3ccccc3c2Cl)cc1OCC |
| InChI | InChI=1S/C21H21ClN2O5/c1-3-27-16-10-9-13(11-17(16)28-4-2)23-18(25)12-29-21(26)20-19(22)14-7-5-6-8-15(14)24-20/h5-11,24H,3-4,12H2,1-2H3,(H,23,25) |
| InChIKey | JANWEPJWMCDXHC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |