C21H18ClF3N2O5 — CID 46459624
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate (PubChem CID 46459624) has the molecular formula C21H18ClF3N2O5 and a molecular weight of 470.83 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46459624 |
| Molecular Formula | C21H18ClF3N2O5 |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-chloro-1H-indole-2-carboxylate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C21H18ClF3N2O5/c1-30-8-9-31-16-7-6-12(21(23,24)25)10-15(16)26-17(28)11-32-20(29)19-18(22)13-4-2-3-5-14(13)27-19/h2-7,10,27H,8-9,11H2,1H3,(H,26,28) |
| InChIKey | UYGMEEHWFFGQIN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|