C20H17F3N2O5 — CID 29338711
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-cyanobenzoate (PubChem CID 29338711) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 29338711 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-cyanobenzoate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C20H17F3N2O5/c1-28-7-8-29-17-6-5-15(20(21,22)23)10-16(17)25-18(26)12-30-19(27)14-4-2-3-13(9-14)11-24/h2-6,9-10H,7-8,12H2,1H3,(H,25,26) |
| InChIKey | LQZKRDHONLCIPA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|