C21H22F3NO5 — CID 2645076
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dimethylbenzoate (PubChem CID 2645076) has the molecular formula C21H22F3NO5 and a molecular weight of 425.40 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dimethylbenzoate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 2645076 |
| Molecular Formula | C21H22F3NO5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dimethylbenzoate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C21H22F3NO5/c1-13-5-4-6-16(14(13)2)20(27)30-12-19(26)25-17-11-15(21(22,23)24)7-8-18(17)29-10-9-28-3/h4-8,11H,9-10,12H2,1-3H3,(H,25,26) |
| InChIKey | VDGVTSNTJWAPBQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|