C18H18F3NO4 — CID 52847984
2-(2-hydroxyphenyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 52847984) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-hydroxyphenyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 52847984 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(2-hydroxyphenyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)Cc1ccccc1O |
| InChI | InChI=1S/C18H18F3NO4/c1-25-8-9-26-16-7-6-13(18(19,20)21)11-14(16)22-17(24)10-12-4-2-3-5-15(12)23/h2-7,11,23H,8-10H2,1H3,(H,22,24) |
| InChIKey | VLHQOTBKSMDYMN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|