C22H24F3NO6 — CID 46789582
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-(2-ethylphenoxy)acetate (PubChem CID 46789582) has the molecular formula C22H24F3NO6 and a molecular weight of 455.43 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-(2-ethylphenoxy)acetate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-(2-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 46789582 |
| Molecular Formula | C22H24F3NO6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-(2-ethylphenoxy)acetate |
| SMILES | CCc1ccccc1OCC(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1OCCOC |
| InChI | InChI=1S/C22H24F3NO6/c1-3-15-6-4-5-7-18(15)31-14-21(28)32-13-20(27)26-17-12-16(22(23,24)25)8-9-19(17)30-11-10-29-2/h4-9,12H,3,10-11,13-14H2,1-2H3,(H,26,27) |
| InChIKey | CRYVWVQJOUJSFS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|