C18H18F3NO6 — CID 27118158
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-methylfuran-2-carboxylate (PubChem CID 27118158) has the molecular formula C18H18F3NO6 and a molecular weight of 401.34 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-methylfuran-2-carboxylate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 27118158 |
| Molecular Formula | C18H18F3NO6 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-methylfuran-2-carboxylate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1occc1C |
| InChI | InChI=1S/C18H18F3NO6/c1-11-5-6-27-16(11)17(24)28-10-15(23)22-13-9-12(18(19,20)21)3-4-14(13)26-8-7-25-2/h3-6,9H,7-8,10H2,1-2H3,(H,22,23) |
| InChIKey | ZGOSFVQFAFBYCJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|