C21H22F3N3O6 — CID 32959229
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-[(carbamoylamino)methyl]benzoate (PubChem CID 32959229) has the molecular formula C21H22F3N3O6 and a molecular weight of 469.42 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-[(carbamoylamino)methyl]benzoate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-[(carbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 32959229 |
| Molecular Formula | C21H22F3N3O6 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-[(carbamoylamino)methyl]benzoate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1ccc(CNC(N)=O)cc1 |
| InChI | InChI=1S/C21H22F3N3O6/c1-31-8-9-32-17-7-6-15(21(22,23)24)10-16(17)27-18(28)12-33-19(29)14-4-2-13(3-5-14)11-26-20(25)30/h2-7,10H,8-9,11-12H2,1H3,(H,27,28)(H3,25,26,30) |
| InChIKey | UKPZXEZYIIHCMH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|