C20H20BrF3N2O4 — CID 26177457
4-bromo-N-[3-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-3-oxopropyl]benzamide (PubChem CID 26177457) has the molecular formula C20H20BrF3N2O4 and a molecular weight of 489.29 g/mol. Its IUPAC name is 4-bromo-N-[3-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-3-oxopropyl]benzamide.
| Compound Name | 4-bromo-N-[3-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 26177457 |
| Molecular Formula | C20H20BrF3N2O4 |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 4-bromo-N-[3-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-3-oxopropyl]benzamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)CCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrF3N2O4/c1-29-10-11-30-17-7-4-14(20(22,23)24)12-16(17)26-18(27)8-9-25-19(28)13-2-5-15(21)6-3-13/h2-7,12H,8-11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | JTCDLNYCECFJTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|