C19H17BrF3NO5 — CID 16539970
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-bromobenzoate (PubChem CID 16539970) has the molecular formula C19H17BrF3NO5 and a molecular weight of 476.25 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-bromobenzoate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 16539970 |
| Molecular Formula | C19H17BrF3NO5 |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-bromobenzoate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrF3NO5/c1-27-8-9-28-16-7-4-13(19(21,22)23)10-15(16)24-17(25)11-29-18(26)12-2-5-14(20)6-3-12/h2-7,10H,8-9,11H2,1H3,(H,24,25) |
| InChIKey | UHPQKUPGZIQXOU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|