C18H17F3N2O5 — CID 7833918
[2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 7833918) has the molecular formula C18H17F3N2O5 and a molecular weight of 398.34 g/mol. Its IUPAC name is [2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7833918 |
| Molecular Formula | C18H17F3N2O5 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C18H17F3N2O5/c1-2-9-27-15-4-3-13(18(19,20)21)10-14(15)22-16(24)11-28-17(25)12-5-7-23(26)8-6-12/h3-8,10H,2,9,11H2,1H3,(H,22,24) |
| InChIKey | ULEDMGOJJLNMMH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|