C16H22F3NO2 — CID 112765185
3,3-dimethyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 112765185) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 112765185 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3,3-dimethyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H22F3NO2/c1-5-8-22-13-7-6-11(16(17,18)19)9-12(13)20-14(21)10-15(2,3)4/h6-7,9H,5,8,10H2,1-4H3,(H,20,21) |
| InChIKey | NSPSDMRLXYXWPG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |