C17H17F3N4O4 — CID 7469228
[2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 7469228) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is [2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7469228 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [2-oxo-2-[2-propoxy-5-(trifluoromethyl)anilino]ethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1nccnc1N |
| InChI | InChI=1S/C17H17F3N4O4/c1-2-7-27-12-4-3-10(17(18,19)20)8-11(12)24-13(25)9-28-16(26)14-15(21)23-6-5-22-14/h3-6,8H,2,7,9H2,1H3,(H2,21,23)(H,24,25) |
| InChIKey | GLVSSXMKCLBCNP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |