C19H22F3N3O5 — CID 55531483
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate (PubChem CID 55531483) has the molecular formula C19H22F3N3O5 and a molecular weight of 429.40 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55531483 |
| Molecular Formula | C19H22F3N3O5 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)Nc2cc(C(F)(F)F)ccc2OCCOC)n[nH]1 |
| InChI | InChI=1S/C19H22F3N3O5/c1-3-4-13-10-15(25-24-13)18(27)30-11-17(26)23-14-9-12(19(20,21)22)5-6-16(14)29-8-7-28-2/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | JMYPMOBOZCOGKN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|