C17H18F3N3O6 — CID 46639734
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 46639734) has the molecular formula C17H18F3N3O6 and a molecular weight of 417.34 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 46639734 |
| Molecular Formula | C17H18F3N3O6 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)c1c(C)noc1N |
| InChI | InChI=1S/C17H18F3N3O6/c1-9-14(15(21)29-23-9)16(25)28-8-13(24)22-11-7-10(17(18,19)20)3-4-12(11)27-6-5-26-2/h3-4,7H,5-6,8,21H2,1-2H3,(H,22,24) |
| InChIKey | ONEGYQURSBWACR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|